ChemNet > CAS > 455-37-8 3-fluorobenzamide
455-37-8 3-fluorobenzamide
produktnavn |
3-fluorobenzamide |
Synonymer |
m-Fluorobenzamide |
Molekylær Formel |
C7H6FNO |
Molekylvekt |
139.127 |
InChI |
InChI=1/C7H6FNO/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,(H2,9,10) |
CAS-nummer |
455-37-8 |
EINECS |
207-247-5 |
Molecular Structure |
|
Tetthet |
1.238g/cm3 |
Smeltepunkt |
129-132℃ |
Kokepunkt |
238.4°C at 760 mmHg |
Brytningsindeks |
1.538 |
Flammepunktet |
98°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|