ChemNet > CAS > 4553-07-5 Ethyl phenylcyanoacetate
4553-07-5 Ethyl phenylcyanoacetate
| produktnavn |
Ethyl phenylcyanoacetate |
| Synonymer |
Phenylcyanoacetic acid ethyl ester; ethyl cyano(phenyl)acetate; ethyl (2R)-cyano(phenyl)ethanoate; ethyl (2S)-cyano(phenyl)ethanoate; ethyl 2-cyano-2-phenylacetate |
| Molekylær Formel |
C11H11NO2 |
| Molekylvekt |
189.2105 |
| InChI |
InChI=1/C11H11NO2/c1-2-14-11(13)10(8-12)9-6-4-3-5-7-9/h3-7,10H,2H2,1H3/t10-/m1/s1 |
| CAS-nummer |
4553-07-5 |
| EINECS |
224-921-4 |
| Molecular Structure |
|
| Tetthet |
1.117g/cm3 |
| Kokepunkt |
275°C at 760 mmHg |
| Brytningsindeks |
1.518 |
| Flammepunktet |
137.5°C |
| Hazard symboler |
 Xn:Harmful;
|
| Risiko Koder |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Sikkerhet Beskrivelse |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|
