ChemNet > CAS > 4630-80-2 Methyl cyclopentanecarboxylate
4630-80-2 Methyl cyclopentanecarboxylate
produktnavn |
Methyl cyclopentanecarboxylate |
Synonymer |
Cyclopentanecarboxylic acid methyl ester; Methyl cyclopentane carboxylate |
Molekylær Formel |
C7H12O2 |
Molekylvekt |
128.169 |
InChI |
InChI=1/C7H12O2/c1-9-7(8)6-4-2-3-5-6/h6H,2-5H2,1H3 |
CAS-nummer |
4630-80-2 |
EINECS |
225-049-7 |
Molecular Structure |
|
Tetthet |
1.014g/cm3 |
Kokepunkt |
159°C at 760 mmHg |
Brytningsindeks |
1.45 |
Flammepunktet |
43.6°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|