ChemNet > CAS > 4630-80-2 Methyl cyclopentanecarboxylate
4630-80-2 Methyl cyclopentanecarboxylate
| produktnavn |
Methyl cyclopentanecarboxylate |
| Synonymer |
Cyclopentanecarboxylic acid methyl ester; Methyl cyclopentane carboxylate |
| Molekylær Formel |
C7H12O2 |
| Molekylvekt |
128.169 |
| InChI |
InChI=1/C7H12O2/c1-9-7(8)6-4-2-3-5-6/h6H,2-5H2,1H3 |
| CAS-nummer |
4630-80-2 |
| EINECS |
225-049-7 |
| Molecular Structure |
|
| Tetthet |
1.014g/cm3 |
| Kokepunkt |
159°C at 760 mmHg |
| Brytningsindeks |
1.45 |
| Flammepunktet |
43.6°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|
