ChemNet > CAS > 4651-82-5 2-aminothiophene-3-carbonitrile
4651-82-5 2-aminothiophene-3-carbonitrile
produktnavn |
2-aminothiophene-3-carbonitrile |
Synonymer |
2-Amino-3-cyanothiophene; 2-Amino-3-thiophenecarbonitrile |
Molekylær Formel |
C5H4N2S |
Molekylvekt |
124.1637 |
InChI |
InChI=1/C5H4N2S/c6-3-4-1-2-8-5(4)7/h1-2H,7H2 |
CAS-nummer |
4651-82-5 |
Molecular Structure |
|
Tetthet |
1.33g/cm3 |
Smeltepunkt |
104℃ |
Kokepunkt |
317.5°C at 760 mmHg |
Brytningsindeks |
1.627 |
Flammepunktet |
145.8°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|