ChemNet > CAS > 465514-33-4 (2-morpholinophenyl)methanol
465514-33-4 (2-morpholinophenyl)methanol
produktnavn |
(2-morpholinophenyl)methanol |
Synonymer |
(2-morpholin-4-ylphenyl)methanol |
Molekylær Formel |
C11H15NO2 |
Molekylvekt |
193.2423 |
InChI |
InChI=1/C11H15NO2/c13-9-10-3-1-2-4-11(10)12-5-7-14-8-6-12/h1-4,13H,5-9H2 |
CAS-nummer |
465514-33-4 |
Molecular Structure |
|
Tetthet |
1.16g/cm3 |
Smeltepunkt |
54℃ |
Kokepunkt |
362.8°C at 760 mmHg |
Brytningsindeks |
1.568 |
Flammepunktet |
173.2°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|