ChemNet > CAS > 481-42-5 Plumbagin
481-42-5 Plumbagin
| produktnavn |
Plumbagin |
| Synonymer |
5-Hydroxy-2-methyl-1,4-naphthoquinone; Plumbagin,95%; Plumbagin from Plumbago indica; 5-hydroxy-2-methylnaphthalene-1,4-dione |
| Molekylær Formel |
C11H8O3 |
| Molekylvekt |
188.1794 |
| InChI |
InChI=1/C11H8O3/c1-6-5-9(13)10-7(11(6)14)3-2-4-8(10)12/h2-5,12H,1H3 |
| CAS-nummer |
481-42-5 |
| EINECS |
207-569-6 |
| Molecular Structure |
|
| Tetthet |
1.354g/cm3 |
| Smeltepunkt |
75-78℃ |
| Kokepunkt |
383.9°C at 760 mmHg |
| Brytningsindeks |
1.63 |
| Flammepunktet |
200.2°C |
| Hazard symboler |
 T:Toxic;
|
| Risiko Koder |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Sikkerhet Beskrivelse |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
