ChemNet > CAS > 4966-90-9 4-Hydroxy-6-methyl-3-nitro-2-pyridone
4966-90-9 4-Hydroxy-6-methyl-3-nitro-2-pyridone
| produktnavn |
4-Hydroxy-6-methyl-3-nitro-2-pyridone |
| Synonymer |
2-hydroxy-6-methyl-3-nitropyridin-4(1H)-one |
| Molekylær Formel |
C6H6N2O4 |
| Molekylvekt |
170.1228 |
| InChI |
InChI=1/C6H6N2O4/c1-3-2-4(9)5(8(11)12)6(10)7-3/h2H,1H3,(H2,7,9,10) |
| CAS-nummer |
4966-90-9 |
| Molecular Structure |
|
| Tetthet |
1.53g/cm3 |
| Smeltepunkt |
293-296℃ |
| Kokepunkt |
265.6°C at 760 mmHg |
| Brytningsindeks |
1.608 |
| Flammepunktet |
114.4°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
