ChemNet > CAS > 50376-99-3 3,4-di(1-methylhydrazino)cyclobut-3-ene-1,2-dione
50376-99-3 3,4-di(1-methylhydrazino)cyclobut-3-ene-1,2-dione
produktnavn |
3,4-di(1-methylhydrazino)cyclobut-3-ene-1,2-dione |
Synonymer |
3,4-bis(1-methylhydrazino)cyclobut-3-ene-1,2-dione |
Molekylær Formel |
C6H10N4O2 |
Molekylvekt |
170.1692 |
InChI |
InChI=1/C6H10N4O2/c1-9(7)3-4(10(2)8)6(12)5(3)11/h7-8H2,1-2H3 |
CAS-nummer |
50376-99-3 |
Molecular Structure |
|
Tetthet |
1.44g/cm3 |
Smeltepunkt |
201℃ |
Kokepunkt |
287.3°C at 760 mmHg |
Brytningsindeks |
1.642 |
Flammepunktet |
127.6°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|