ChemNet > CAS > 5081-42-5 Methyl 2-nitro-3,4,5-trimethoxybenzoate
5081-42-5 Methyl 2-nitro-3,4,5-trimethoxybenzoate
produktnavn |
Methyl 2-nitro-3,4,5-trimethoxybenzoate |
Synonymer |
2-Nitro-3,4,5-trimethoxybenzoic acid methyl ester; methyl 3,4,5-trimethoxy-2-nitrobenzoate |
Molekylær Formel |
C11H13NO7 |
Molekylvekt |
271.2234 |
InChI |
InChI=1/C11H13NO7/c1-16-7-5-6(11(13)19-4)8(12(14)15)10(18-3)9(7)17-2/h5H,1-4H3 |
CAS-nummer |
5081-42-5 |
EINECS |
225-794-8 |
Molecular Structure |
|
Tetthet |
1.284g/cm3 |
Kokepunkt |
420°C at 760 mmHg |
Brytningsindeks |
1.523 |
Flammepunktet |
188.9°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|