ChemNet > CAS > 51628-12-7 4-Iodophenylacetonitrile
51628-12-7 4-Iodophenylacetonitrile
produktnavn |
4-Iodophenylacetonitrile |
Synonymer |
4-Iodobenzyl cyanide |
Molekylær Formel |
C8H6IN |
Molekylvekt |
243.0444 |
InChI |
InChI=1/C8H6IN/c9-8-3-1-7(2-4-8)5-6-10/h1-4H,5H2 |
CAS-nummer |
51628-12-7 |
Molecular Structure |
|
Tetthet |
1.764g/cm3 |
Kokepunkt |
285.8°C at 760 mmHg |
Brytningsindeks |
1.624 |
Flammepunktet |
126.6°C |
Hazard symboler |
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|