ChemNet > CAS > 52287-51-1 3,4-Ethylenedioxybromobenzene
52287-51-1 3,4-Ethylenedioxybromobenzene
produktnavn |
3,4-Ethylenedioxybromobenzene |
Synonymer |
3,4-(Ethylenedioxy)bromobenzene; 6-Bromo-1,4-benzodioxane; 6-Bromo-2,3-dihydro-1,4-benzodioxine |
Molekylær Formel |
C8H7BrO2 |
Molekylvekt |
215.044 |
InChI |
InChI=1/C8H7BrO2/c9-6-1-2-7-8(5-6)11-4-3-10-7/h1-2,5H,3-4H2 |
CAS-nummer |
52287-51-1 |
EINECS |
257-817-2 |
Molecular Structure |
|
Tetthet |
1.598g/cm3 |
Kokepunkt |
258.299°C at 760 mmHg |
Brytningsindeks |
1.579 |
Flammepunktet |
117.638°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|