ChemNet > CAS > 523-31-9 dibenzyl phthalate
523-31-9 dibenzyl phthalate
produktnavn |
dibenzyl phthalate |
Synonymer |
Dibenzyl phthalate, (Phthalic acid dibenzyl ester); Phthalic acid dibenzyl ester; dibenzyl benzene-1,3-dicarboxylate |
Molekylær Formel |
C22H18O4 |
Molekylvekt |
346.3759 |
InChI |
InChI=1/C22H18O4/c23-21(25-15-17-8-3-1-4-9-17)19-12-7-13-20(14-19)22(24)26-16-18-10-5-2-6-11-18/h1-14H,15-16H2 |
CAS-nummer |
523-31-9 |
EINECS |
208-344-5 |
Molecular Structure |
|
Tetthet |
1.208g/cm3 |
Kokepunkt |
493.8°C at 760 mmHg |
Brytningsindeks |
1.605 |
Flammepunktet |
248.8°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|