ChemNet > CAS > 529-84-0 4-Methylesculetin
529-84-0 4-Methylesculetin
| produktnavn |
4-Methylesculetin |
| Synonymer |
6,7-Dihydroxy-4-methylcoumarin; 4-Methylesculetin, (6,7-Dihydroxy-4-methylcoumarin); 4-methylaesculetin; 6,7-dihydroxy-4-methyl-2H-chromen-2-one |
| Molekylær Formel |
C10H8O4 |
| Molekylvekt |
192.1681 |
| InChI |
InChI=1/C10H8O4/c1-5-2-10(13)14-9-4-8(12)7(11)3-6(5)9/h2-4,11-12H,1H3 |
| CAS-nummer |
529-84-0 |
| EINECS |
208-470-0 |
| Molecular Structure |
|
| Tetthet |
1.456g/cm3 |
| Smeltepunkt |
274-276℃ |
| Kokepunkt |
455.5°C at 760 mmHg |
| Brytningsindeks |
1.651 |
| Flammepunktet |
190.7°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|
