ChemNet > CAS > 5328-01-8 1-Ethoxynaphthalene
5328-01-8 1-Ethoxynaphthalene
produktnavn |
1-Ethoxynaphthalene |
Synonymer |
Ethyl 1-naphthyl ether; Ethyl alpha-naphthyl ether; ; alpha-Ethoxynaphthalene; Naphthalene, 1-ethoxy-; 1-Naphthol ethyl ether; Naphtholethylether |
Molekylær Formel |
C12H12O |
Molekylvekt |
172.2231 |
InChI |
InChI=1/C12H12O/c1-2-13-12-9-5-7-10-6-3-4-8-11(10)12/h3-9H,2H2,1H3 |
CAS-nummer |
5328-01-8 |
EINECS |
226-213-0 |
Molecular Structure |
|
Tetthet |
1.049g/cm3 |
Kokepunkt |
280.5°C at 760 mmHg |
Brytningsindeks |
1.59 |
Flammepunktet |
109.4°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|