ChemNet > CAS > 543-20-4 Succinyl chloride
543-20-4 Succinyl chloride
produktnavn |
Succinyl chloride |
Synonymer |
Succinic acid dichloride; Succinyl dichloride; Succinoyl dichloride; Butanedioyl dichloride |
Molekylær Formel |
C4H4Cl2O2 |
Molekylvekt |
154.9794 |
InChI |
InChI=1/C4H4Cl2O2/c5-3(7)1-2-4(6)8/h1-2H2 |
CAS-nummer |
543-20-4 |
EINECS |
208-838-0 |
Molecular Structure |
|
Tetthet |
1.389g/cm3 |
Smeltepunkt |
16-17℃ |
Kokepunkt |
193.4°C at 760 mmHg |
Brytningsindeks |
1.456 |
Flammepunktet |
76.7°C |
Hazard symboler |
C:Corrosive;
|
Risiko Koder |
R34:Causes burns.;
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|