ChemNet > CAS > 5445-22-7 Methyl 2-bromooctanoate
5445-22-7 Methyl 2-bromooctanoate
produktnavn |
Methyl 2-bromooctanoate |
Synonymer |
2-Bromooctanoic acid methyl ester; 2-bromo-octanoicacimethylester; Methyl2-bromooctanoate,99+% |
Molekylær Formel |
C9H17BrO2 |
Molekylvekt |
237.1341 |
InChI |
InChI=1/C9H17BrO2/c1-3-4-5-6-7-8(10)9(11)12-2/h8H,3-7H2,1-2H3 |
CAS-nummer |
5445-22-7 |
EINECS |
226-644-4 |
Molecular Structure |
|
Tetthet |
1.221g/cm3 |
Kokepunkt |
227.7°C at 760 mmHg |
Brytningsindeks |
1.46 |
Flammepunktet |
101.9°C |
Hazard symboler |
|
Risiko Koder |
R36/38:Irritating to eyes and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|