ChemNet > CAS > 55752-58-4 2,3-Dimethylphenylthiourea
55752-58-4 2,3-Dimethylphenylthiourea
produktnavn |
2,3-Dimethylphenylthiourea |
Synonymer |
1-(2,3-dimethylphenyl)thiourea |
Molekylær Formel |
C9H12N2S |
Molekylvekt |
180.27 |
InChI |
InChI=1/C9H12N2S/c1-6-4-3-5-8(7(6)2)11-9(10)12/h3-5H,1-2H3,(H3,10,11,12) |
CAS-nummer |
55752-58-4 |
Molecular Structure |
|
Tetthet |
1.2g/cm3 |
Kokepunkt |
294.3°C at 760 mmHg |
Brytningsindeks |
1.674 |
Flammepunktet |
131.8°C |
Hazard symboler |
|
Risiko Koder |
R25:Toxic if swallowed.;
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|