ChemNet > CAS > 55836-69-6 3-ethoxybenzamide
55836-69-6 3-ethoxybenzamide
| produktnavn |
3-ethoxybenzamide |
| Synonymer |
m-Ethoxybenzamide; Benzamide, 3-ethoxy- |
| Molekylær Formel |
C9H11NO2 |
| Molekylvekt |
165.1891 |
| InChI |
InChI=1/C9H11NO2/c1-2-12-8-5-3-4-7(6-8)9(10)11/h3-6H,2H2,1H3,(H2,10,11) |
| CAS-nummer |
55836-69-6 |
| EINECS |
259-846-6 |
| Molecular Structure |
|
| Tetthet |
1.111g/cm3 |
| Smeltepunkt |
138-140℃ |
| Kokepunkt |
293.4°C at 760 mmHg |
| Brytningsindeks |
1.538 |
| Flammepunktet |
145.8°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
