CAS No: 578021-55-3, Chemical Name: 1,4-Piperidinedicarboxylic acid, 4-ethyl-, 1-(1,1-dimethylethyl) 4-methyl ester
the physical and chemical property of 578021-55-3, 1,4-Piperidinedicarboxylic acid, 4-ethyl-, 1-(1,1-dimethylethyl) 4-methyl ester is provided by ChemNet.com
ChemNet > CAS > 578021-55-3 1,4-Piperidinedicarboxylic acid, 4-ethyl-, 1-(1,1-dimethylethyl) 4-methyl ester
578021-55-3 1,4-Piperidinedicarboxylic acid, 4-ethyl-, 1-(1,1-dimethylethyl) 4-methyl ester
| produktnavn |
1,4-Piperidinedicarboxylic acid, 4-ethyl-, 1-(1,1-dimethylethyl) 4-methyl ester |
| Synonymer |
methyl n-boc-4-ethylpiperidine-4-carboxylate; piperidine-1,4-dicarboxylic acid |
| Molekylær Formel |
C7H11NO4 |
| Molekylvekt |
173.1665 |
| InChI |
InChI=1/C7H11NO4/c9-6(10)5-1-3-8(4-2-5)7(11)12/h5H,1-4H2,(H,9,10)(H,11,12) |
| CAS-nummer |
578021-55-3 |
| Molecular Structure |
|
| Tetthet |
1.419g/cm3 |
| Kokepunkt |
391.707°C at 760 mmHg |
| Brytningsindeks |
1.549 |
| Flammepunktet |
190.698°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
|
|
