ChemNet > CAS > 579-43-1 1,2-Diphenyl-1,2-ethanediol (meso)
579-43-1 1,2-Diphenyl-1,2-ethanediol (meso)
produktnavn |
1,2-Diphenyl-1,2-ethanediol (meso) |
Synonymer |
meso-Hydrobenzoin; meso-1,2-Diphenyl-1,2-ethanediol; (1R,2S)-1,2-diphenylethane-1,2-diol |
Molekylær Formel |
C14H14O2 |
Molekylvekt |
214.2598 |
InChI |
InChI=1/C14H14O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-16H/t13-,14+ |
CAS-nummer |
579-43-1 |
EINECS |
207-758-3 |
Molecular Structure |
|
Tetthet |
1.193g/cm3 |
Smeltepunkt |
134-137℃ |
Kokepunkt |
373°C at 760 mmHg |
Brytningsindeks |
1.624 |
Flammepunktet |
179.8°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|