ChemNet > CAS > 583-03-9 Fenipentol
583-03-9 Fenipentol
produktnavn |
Fenipentol |
Synonymer |
.alpha.-Butylbenzenemethanol; .alpha.-Butylbenzyl alcohol; 1-Phenylpentan-1-ol; 583-03-9; a-Butylbenzyl Alcohol; Benzenemethanol, .alpha.-butyl-; benzenemethanol, alpha-butyl-; Benzyl alcohol, .alpha.-butyl-; Butyl hydroxy toluene |
Molekylær Formel |
C11H16O |
Molekylvekt |
164.2441 |
InChI |
InChI=1/C11H16O/c1-2-3-9-11(12)10-7-5-4-6-8-10/h4-8,11-12H,2-3,9H2,1H3 |
CAS-nummer |
583-03-9 |
EINECS |
209-493-9 |
Molecular Structure |
|
Tetthet |
0.965g/cm3 |
Kokepunkt |
245.2°C at 760 mmHg |
Brytningsindeks |
1.514 |
Flammepunktet |
110.7°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|