ChemNet > CAS > 58586-81-5 4-Ethoxybenzhydrazide
58586-81-5 4-Ethoxybenzhydrazide
produktnavn |
4-Ethoxybenzhydrazide |
Synonymer |
4-ethoxybenzohydrazide |
Molekylær Formel |
C9H12N2O2 |
Molekylvekt |
180.2038 |
InChI |
InChI=1/C9H12N2O2/c1-2-13-8-5-3-7(4-6-8)9(12)11-10/h3-6H,2,10H2,1H3,(H,11,12) |
CAS-nummer |
58586-81-5 |
Molecular Structure |
|
Tetthet |
1.144g/cm3 |
Brytningsindeks |
1.549 |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|