ChemNet > CAS > 59-82-5 5-Nitro-2-furonitrile
59-82-5 5-Nitro-2-furonitrile
produktnavn |
5-Nitro-2-furonitrile |
Synonymer |
5-Nitro-2-furancarbonitrile; 5-nitrofuran-2-carbonitrile |
Molekylær Formel |
C5H2N2O3 |
Molekylvekt |
138.081 |
InChI |
InChI=1/C5H2N2O3/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
CAS-nummer |
59-82-5 |
Molecular Structure |
|
Tetthet |
1.46g/cm3 |
Kokepunkt |
234.7°C at 760 mmHg |
Brytningsindeks |
1.544 |
Flammepunktet |
95.7°C |
Hazard symboler |
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|