ChemNet > CAS > 5905-69-1 4-(difluoromethoxy)bromobenzene
5905-69-1 4-(difluoromethoxy)bromobenzene
produktnavn |
4-(difluoromethoxy)bromobenzene |
Synonymer |
1-Bromo-4-(difluoromethoxy)benzene; p-Difluoromethoxybromobenzene |
Molekylær Formel |
C7H5BrF2O |
Molekylvekt |
223.0148 |
InChI |
InChI=1/C7H5BrF2O/c8-5-1-3-6(4-2-5)11-7(9)10/h1-4,7H |
CAS-nummer |
5905-69-1 |
Molecular Structure |
|
Tetthet |
1.583g/cm3 |
Kokepunkt |
205.406°C at 760 mmHg |
Brytningsindeks |
1.492 |
Flammepunktet |
92.591°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|