ChemNet > CAS > 591-23-1 3-Methylcyclohexanol, mixture of cis and trans
591-23-1 3-Methylcyclohexanol, mixture of cis and trans
produktnavn |
3-Methylcyclohexanol, mixture of cis and trans |
Synonymer |
3-Methylcyclohexanol (cis+trans); 3-Methylcyclohexanol; (1S,3R)-3-methylcyclohexanol; (1R,3R)-3-methylcyclohexanol; (1S,3S)-3-methylcyclohexanol |
Molekylær Formel |
C7H14O |
Molekylvekt |
114.1855 |
InChI |
InChI=1/C7H14O/c1-6-3-2-4-7(8)5-6/h6-8H,2-5H2,1H3/t6-,7-/m0/s1 |
CAS-nummer |
591-23-1 |
EINECS |
209-709-1 |
Molecular Structure |
|
Tetthet |
0.925g/cm3 |
Smeltepunkt |
-74℃ |
Kokepunkt |
170.3°C at 760 mmHg |
Brytningsindeks |
1.462 |
Flammepunktet |
62.8°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|