ChemNet > CAS > 598-52-7 N-Methylthiourea
598-52-7 N-Methylthiourea
produktnavn |
N-Methylthiourea |
Synonymer |
N-Methyl thiourea; 1-methylthiourea |
Molekylær Formel |
C2H6N2S |
Molekylvekt |
90.1474 |
InChI |
InChI=1/C2H6N2S/c1-4-2(3)5/h1H3,(H3,3,4,5) |
CAS-nummer |
598-52-7 |
EINECS |
209-936-6 |
Molecular Structure |
|
Tetthet |
1.14g/cm3 |
Smeltepunkt |
118-123℃ |
Kokepunkt |
141.1°C at 760 mmHg |
Brytningsindeks |
1.564 |
Flammepunktet |
39.1°C |
Hazard symboler |
T:Toxic;
|
Risiko Koder |
R25:Toxic if swallowed.;
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|