ChemNet > CAS > 605-02-7 1-Phenylnaphthalene
605-02-7 1-Phenylnaphthalene
produktnavn |
1-Phenylnaphthalene |
Synonymer |
NSC 5257; Naphthalene, 1-phenyl-; Naphthalene, 1-phenyl- (8CI)(9CI) |
Molekylær Formel |
C16H12 |
Molekylvekt |
204.2665 |
InChI |
InChI=1/C16H12/c1-2-7-13(8-3-1)16-12-6-10-14-9-4-5-11-15(14)16/h1-12H |
CAS-nummer |
605-02-7 |
EINECS |
210-081-6 |
Molecular Structure |
|
Tetthet |
1.081g/cm3 |
Kokepunkt |
336.4°C at 760 mmHg |
Brytningsindeks |
1.647 |
Flammepunktet |
148.2°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|