ChemNet > CAS > 606-27-9 Methyl 2-nitrobenzoate
606-27-9 Methyl 2-nitrobenzoate
produktnavn |
Methyl 2-nitrobenzoate |
Synonymer |
2-Nitrobenzoic acid methyl ester |
Molekylær Formel |
C8H7NO4 |
Molekylvekt |
181.1455 |
InChI |
InChI=1/C8H7NO4/c1-13-8(10)6-4-2-3-5-7(6)9(11)12/h2-5H,1H3 |
CAS-nummer |
606-27-9 |
EINECS |
210-111-8 |
Molecular Structure |
|
Tetthet |
1.301g/cm3 |
Smeltepunkt |
-13℃ |
Kokepunkt |
275°C at 760 mmHg |
Brytningsindeks |
1.553 |
Flammepunktet |
124.8°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|