ChemNet > CAS > 608-08-2 Indoxyl acetate
608-08-2 Indoxyl acetate
| produktnavn |
Indoxyl acetate |
| Synonymer |
3-Acetoxyindole~Indolyl acetate~Y-acetate; Indoxyl acetate 3-Indoxyl acetate; 3-Indolyl acetate; 3-Acetoxyindole; 1H-indol-3-yl acetate |
| Molekylær Formel |
C10H9NO2 |
| Molekylvekt |
175.184 |
| InChI |
InChI=1/C10H9NO2/c1-7(12)13-10-6-11-9-5-3-2-4-8(9)10/h2-6,11H,1H3 |
| CAS-nummer |
608-08-2 |
| EINECS |
210-154-2 |
| Molecular Structure |
|
| Tetthet |
1.255g/cm3 |
| Smeltepunkt |
128-131℃ |
| Kokepunkt |
339.1°C at 760 mmHg |
| Brytningsindeks |
1.633 |
| Flammepunktet |
158.9°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|
