ChemNet > CAS > 613-03-6 1,2,4-Triacetoxybenzene
613-03-6 1,2,4-Triacetoxybenzene
| produktnavn |
1,2,4-Triacetoxybenzene |
| Synonymer |
1,2,4-Phenenyl triacetate; benzene-1,2,4-triyl triacetate; 2-[(1-hydroxyethenyl)oxy]benzene-1,4-diyl diacetate |
| Molekylær Formel |
C12H12O6 |
| Molekylvekt |
252.2201 |
| InChI |
InChI=1/C12H12O6/c1-7(13)16-10-4-5-11(17-8(2)14)12(6-10)18-9(3)15/h4-6,15H,3H2,1-2H3 |
| CAS-nummer |
613-03-6 |
| EINECS |
210-327-2 |
| Molecular Structure |
|
| Tetthet |
1.276g/cm3 |
| Smeltepunkt |
98-100℃ |
| Kokepunkt |
401°C at 760 mmHg |
| Brytningsindeks |
1.533 |
| Flammepunktet |
153.2°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|
