ChemNet > CAS > 61424-26-8 3-Benzylaniline
61424-26-8 3-Benzylaniline
produktnavn |
3-Benzylaniline |
Molekylær Formel |
C13H13N |
Molekylvekt |
183.249 |
InChI |
InChI=1/C13H13N/c14-13-8-4-7-12(10-13)9-11-5-2-1-3-6-11/h1-8,10H,9,14H2 |
CAS-nummer |
61424-26-8 |
Molecular Structure |
|
Tetthet |
1.07g/cm3 |
Kokepunkt |
327.2°C at 760 mmHg |
Brytningsindeks |
1.616 |
Flammepunktet |
162.5°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|