ChemNet > CAS > 6276-04-6 1-iodo-3,5-dinitrobenzene
6276-04-6 1-iodo-3,5-dinitrobenzene
produktnavn |
1-iodo-3,5-dinitrobenzene |
Molekylær Formel |
C6H3IN2O4 |
Molekylvekt |
294.0035 |
InChI |
InChI=1/C6H3IN2O4/c7-4-1-5(8(10)11)3-6(2-4)9(12)13/h1-3H |
CAS-nummer |
6276-04-6 |
Molecular Structure |
|
Tetthet |
2.174g/cm3 |
Smeltepunkt |
108-111℃ |
Kokepunkt |
346°C at 760 mmHg |
Brytningsindeks |
1.699 |
Flammepunktet |
163.1°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R42/43:May cause sensitization by inhalation and skin contact.;
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24:Avoid contact with skin.;
S37:Wear suitable gloves.;
|
|