ChemNet > CAS > 6326-44-9 Diethyl formamidomalonate
6326-44-9 Diethyl formamidomalonate
produktnavn |
Diethyl formamidomalonate |
Synonymer |
Formamidomalonic acid diethyl ester; diethyl (formylamino)propanedioate; Diethylformamidomalonate |
Molekylær Formel |
C8H13NO5 |
Molekylvekt |
203.1925 |
InChI |
InChI=1/C8H13NO5/c1-3-13-7(11)6(9-5-10)8(12)14-4-2/h5-6H,3-4H2,1-2H3,(H,9,10) |
CAS-nummer |
6326-44-9 |
EINECS |
228-692-1 |
Molecular Structure |
|
Tetthet |
1.167g/cm3 |
Smeltepunkt |
51-56℃ |
Kokepunkt |
316.8°C at 760 mmHg |
Brytningsindeks |
1.445 |
Flammepunktet |
165.7°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|