ChemNet > CAS > 6344-60-1 1-Hydroxy-9-fluorenone
6344-60-1 1-Hydroxy-9-fluorenone
produktnavn |
1-Hydroxy-9-fluorenone |
Synonymer |
1-Hydroxyfluoren-9-one; 1-hydroxy-9H-fluoren-9-one |
Molekylær Formel |
C13H8O2 |
Molekylvekt |
196.2014 |
InChI |
InChI=1/C13H8O2/c14-11-7-3-6-9-8-4-1-2-5-10(8)13(15)12(9)11/h1-7,14H |
CAS-nummer |
6344-60-1 |
EINECS |
228-746-4 |
Molecular Structure |
|
Tetthet |
1.369g/cm3 |
Smeltepunkt |
116-119℃ |
Kokepunkt |
383.4°C at 760 mmHg |
Brytningsindeks |
1.707 |
Flammepunktet |
163.7°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|