ChemNet > CAS > 64399-28-6 1-(4-Chlorophenyl)-1-cyclohexanecarbonitrile
64399-28-6 1-(4-Chlorophenyl)-1-cyclohexanecarbonitrile
produktnavn |
1-(4-Chlorophenyl)-1-cyclohexanecarbonitrile |
Synonymer |
1-(4-Chlorophenyl)cyclohexanecarbonitrile |
Molekylær Formel |
C13H14ClN |
Molekylvekt |
219.71 |
InChI |
InChI=1/C13H14ClN/c14-12-6-4-11(5-7-12)13(10-15)8-2-1-3-9-13/h4-7H,1-3,8-9H2 |
CAS-nummer |
64399-28-6 |
EINECS |
264-872-6 |
Molecular Structure |
|
Tetthet |
1.14g/cm3 |
Smeltepunkt |
88-92℃ |
Kokepunkt |
350.5°C at 760 mmHg |
Brytningsindeks |
1.559 |
Flammepunktet |
143.5°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|