ChemNet > CAS > 64415-11-8 4,6-Dichloro-2-methylthio-5-phenylpyrimidine
64415-11-8 4,6-Dichloro-2-methylthio-5-phenylpyrimidine
produktnavn |
4,6-Dichloro-2-methylthio-5-phenylpyrimidine |
Synonymer |
4,6-dichloro-2-(methylsulfanyl)-5-phenylpyrimidine |
Molekylær Formel |
C11H8Cl2N2S |
Molekylvekt |
271.1656 |
InChI |
InChI=1/C11H8Cl2N2S/c1-16-11-14-9(12)8(10(13)15-11)7-5-3-2-4-6-7/h2-6H,1H3 |
CAS-nummer |
64415-11-8 |
EINECS |
264-877-3 |
Molecular Structure |
|
Tetthet |
1.43g/cm3 |
Smeltepunkt |
107-111℃ |
Kokepunkt |
364.3°C at 760 mmHg |
Brytningsindeks |
1.657 |
Flammepunktet |
174.1°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
|
|