ChemNet > CAS > 656-31-5 2-fluorophenylurea
656-31-5 2-fluorophenylurea
| produktnavn |
2-fluorophenylurea |
| Synonymer |
(2-Fluorophenyl)urea; (o-Fluorophenyl)urea; Urea, (o-fluorophenyl)-; 1-(2-fluorophenyl)urea |
| Molekylær Formel |
C7H7FN2O |
| Molekylvekt |
154.1417 |
| InChI |
InChI=1/C7H7FN2O/c8-5-3-1-2-4-6(5)10-7(9)11/h1-4H,(H3,9,10,11) |
| CAS-nummer |
656-31-5 |
| EINECS |
211-513-6 |
| Molecular Structure |
|
| Tetthet |
1.353g/cm3 |
| Kokepunkt |
228.1°C at 760 mmHg |
| Brytningsindeks |
1.608 |
| Flammepunktet |
91.7°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
