ChemNet > CAS > 67869-70-9 7-(chloromethyl)-3,4-dihydro-2H-1,5-benzodioxepine
67869-70-9 7-(chloromethyl)-3,4-dihydro-2H-1,5-benzodioxepine
produktnavn |
7-(chloromethyl)-3,4-dihydro-2H-1,5-benzodioxepine |
Synonymer |
7-(chloromethyl)-3,4-dihydro-2H-benzo[b][1,4]dioxepine |
Molekylær Formel |
C10H11ClO2 |
Molekylvekt |
198.6461 |
InChI |
InChI=1/C10H11ClO2/c11-7-8-2-3-9-10(6-8)13-5-1-4-12-9/h2-3,6H,1,4-5,7H2 |
CAS-nummer |
67869-70-9 |
Molecular Structure |
|
Tetthet |
1.213g/cm3 |
Kokepunkt |
296.429°C at 760 mmHg |
Brytningsindeks |
1.54 |
Flammepunktet |
123.16°C |
Hazard symboler |
C:Corrosive;
|
Risiko Koder |
R34:Causes burns.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|