ChemNet > CAS > 68282-47-3 2-phenyl-1H-imidazole-4-carbaldehyde
68282-47-3 2-phenyl-1H-imidazole-4-carbaldehyde
| produktnavn |
2-phenyl-1H-imidazole-4-carbaldehyde |
| Synonymer |
2-phenyl-1H-imidazole-5-carbaldehyde |
| Molekylær Formel |
C10H8N2O |
| Molekylvekt |
172.1833 |
| InChI |
InChI=1/C10H8N2O/c13-7-9-6-11-10(12-9)8-4-2-1-3-5-8/h1-7H,(H,11,12) |
| CAS-nummer |
68282-47-3 |
| Molecular Structure |
|
| Tetthet |
1.248g/cm3 |
| Smeltepunkt |
167℃ |
| Kokepunkt |
418.9°C at 760 mmHg |
| Brytningsindeks |
1.646 |
| Flammepunktet |
208.7°C |
| Hazard symboler |
 Xn:Harmful;
|
| Risiko Koder |
R21/22:Harmful in contact with skin and if swallowed.;
|
| Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|
