ChemNet > CAS > 6833-15-4 4-chlorobenzanilide
6833-15-4 4-chlorobenzanilide
produktnavn |
4-chlorobenzanilide |
Synonymer |
4-chloro-N-phenylbenzamide |
Molekylær Formel |
C13H10ClNO |
Molekylvekt |
231.6776 |
InChI |
InChI=1/C13H10ClNO/c14-11-8-6-10(7-9-11)13(16)15-12-4-2-1-3-5-12/h1-9H,(H,15,16) |
CAS-nummer |
6833-15-4 |
Molecular Structure |
|
Tetthet |
1.285g/cm3 |
Smeltepunkt |
199-201℃ |
Kokepunkt |
288.6°C at 760 mmHg |
Brytningsindeks |
1.649 |
Flammepunktet |
128.3°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|