ChemNet > CAS > 697-90-5 2,4-Dichloro-6-iodoaniline
697-90-5 2,4-Dichloro-6-iodoaniline
produktnavn |
2,4-Dichloro-6-iodoaniline |
Molekylær Formel |
C6H4Cl2IN |
Molekylvekt |
287.9131 |
InChI |
InChI=1/C6H4Cl2IN/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,10H2 |
CAS-nummer |
697-90-5 |
Molecular Structure |
|
Tetthet |
2.091g/cm3 |
Kokepunkt |
303.8°C at 760 mmHg |
Brytningsindeks |
1.699 |
Flammepunktet |
137.5°C |
Hazard symboler |
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|