ChemNet > CAS > 700-44-7 6-Methoxysalicylaldehyde
700-44-7 6-Methoxysalicylaldehyde
produktnavn |
6-Methoxysalicylaldehyde |
Synonymer |
2-Hydroxy-6-methoxybenzaldehyde; 6-Hydroxy-o-anisaldehyde; 2-hydroxy-6-methoxy benzaldehyde |
Molekylær Formel |
C8H8O3 |
Molekylvekt |
152.1473 |
InChI |
InChI=1/C8H8O3/c1-11-8-4-2-3-7(10)6(8)5-9/h2-5,10H,1H3 |
CAS-nummer |
700-44-7 |
EINECS |
211-844-6 |
Molecular Structure |
|
Tetthet |
1.231g/cm3 |
Kokepunkt |
262.9°C at 760 mmHg |
Brytningsindeks |
1.587 |
Flammepunktet |
107.8°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|