ChemNet > CAS > 703-23-1 2-Hydroxy-6-methoxyacetophenone
703-23-1 2-Hydroxy-6-methoxyacetophenone
| produktnavn |
2-Hydroxy-6-methoxyacetophenone |
| Synonymer |
1-(2-Hydroxy-6-methoxyphenyl)ethan-1-one; 1-(2-hydroxy-6-methoxyphenyl)ethanone; 2'-Hydroxy-6'-methoxyacetophenone |
| Molekylær Formel |
C9H10O3 |
| Molekylvekt |
166.1739 |
| InChI |
InChI=1/C9H10O3/c1-6(10)9-7(11)4-3-5-8(9)12-2/h3-5,11H,1-2H3 |
| CAS-nummer |
703-23-1 |
| EINECS |
211-872-9 |
| Molecular Structure |
|
| Tetthet |
1.158g/cm3 |
| Smeltepunkt |
58-60℃ |
| Kokepunkt |
259.5°C at 760 mmHg |
| Brytningsindeks |
1.537 |
| Flammepunktet |
108.1°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
