ChemNet > CAS > 712-97-0 6-Nitropiperonal
712-97-0 6-Nitropiperonal
produktnavn |
6-Nitropiperonal |
Synonymer |
(3,4-Methylenedioxy-6-nitrobenzald; 4,5-Methylenedioxy-2-nitrobenzaldehyde; 6-Nitro-1,3-benzodioxole-5-carboxaldehyde; 6-nitro-1,3-benzodioxole-5-carbaldehyde; 4,5-(Methylenedioxy)-2-nitrobenzaldehyde |
Molekylær Formel |
C8H5NO5 |
Molekylvekt |
195.129 |
InChI |
InChI=1/C8H5NO5/c10-3-5-1-7-8(14-4-13-7)2-6(5)9(11)12/h1-3H,4H2 |
CAS-nummer |
712-97-0 |
EINECS |
211-926-1 |
Molecular Structure |
|
Tetthet |
1.572g/cm3 |
Smeltepunkt |
93-96℃ |
Kokepunkt |
365.9°C at 760 mmHg |
Brytningsindeks |
1.658 |
Flammepunktet |
195°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|