ChemNet > CAS > 72707-66-5 2-(Bromomethyl)acrylic acid
72707-66-5 2-(Bromomethyl)acrylic acid
| produktnavn |
2-(Bromomethyl)acrylic acid |
| Synonymer |
2-(bromomethyl)propenoic acid; 2-(bromomethyl)prop-2-enoic acid |
| Molekylær Formel |
C4H5BrO2 |
| Molekylvekt |
164.9853 |
| InChI |
InChI=1/C4H5BrO2/c1-3(2-5)4(6)7/h1-2H2,(H,6,7) |
| CAS-nummer |
72707-66-5 |
| EINECS |
276-774-0 |
| Molecular Structure |
|
| Tetthet |
1.696g/cm3 |
| Smeltepunkt |
70-73℃ |
| Kokepunkt |
268.8°C at 760 mmHg |
| Brytningsindeks |
1.517 |
| Flammepunktet |
116.4°C |
| Hazard symboler |
|
| Risiko Koder |
R34:Causes burns.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
