ChemNet > CAS > 73033-58-6 5-Chloro-2-nitrobenzyl alcohol
73033-58-6 5-Chloro-2-nitrobenzyl alcohol
produktnavn |
5-Chloro-2-nitrobenzyl alcohol |
Synonymer |
(5-chloro-2-nitrophenyl)methanol; 5-Chloro-2-nitrobenzenemethanol |
Molekylær Formel |
C7H6ClNO3 |
Molekylvekt |
187.5804 |
InChI |
InChI=1/C7H6ClNO3/c8-6-1-2-7(9(11)12)5(3-6)4-10/h1-3,10H,4H2 |
CAS-nummer |
73033-58-6 |
EINECS |
277-241-5 |
Molecular Structure |
|
Tetthet |
1.476g/cm3 |
Smeltepunkt |
77-82℃ |
Kokepunkt |
316.1°C at 760 mmHg |
Brytningsindeks |
1.611 |
Flammepunktet |
145°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|