ChemNet > CAS > 73960-07-3 4-(Difluoromethoxy)benzaldehyde
73960-07-3 4-(Difluoromethoxy)benzaldehyde
produktnavn |
4-(Difluoromethoxy)benzaldehyde |
Synonymer |
p-(Difluoromethoxy)benzaldehyde |
Molekylær Formel |
C8H6F2O2 |
Molekylvekt |
172.1288 |
InChI |
InChI=1/C8H6F2O2/c9-8(10)12-7-3-1-6(5-11)2-4-7/h1-5,8H |
CAS-nummer |
73960-07-3 |
EINECS |
277-653-5 |
Molecular Structure |
|
Tetthet |
1.262g/cm3 |
Kokepunkt |
234.7°C at 760 mmHg |
Brytningsindeks |
1.497 |
Flammepunktet |
93.1°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|