ChemNet > CAS > 74003-55-7 3,4-Dibromobenzaldehyde
74003-55-7 3,4-Dibromobenzaldehyde
produktnavn |
3,4-Dibromobenzaldehyde |
Synonymer |
3,4-Dibromo-benzaldehyde |
Molekylær Formel |
C7H4Br2O |
Molekylvekt |
263.9141 |
InChI |
InChI=1/C7H4Br2O/c8-6-2-1-5(4-10)3-7(6)9/h1-4H |
CAS-nummer |
74003-55-7 |
Molecular Structure |
|
Tetthet |
1.977g/cm3 |
Kokepunkt |
303.6°C at 760 mmHg |
Brytningsindeks |
1.645 |
Flammepunktet |
123°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|