ChemNet > CAS > 75-27-4 Bromodichloromethane
75-27-4 Bromodichloromethane
| produktnavn |
Bromodichloromethane |
| Synonymer |
FC-20B1 |
| Molekylær Formel |
CHBrCl2 |
| Molekylvekt |
163.8286 |
| InChI |
InChI=1/CHBrCl2/c2-1(3)4/h1H |
| CAS-nummer |
75-27-4 |
| EINECS |
200-856-7 |
| Molecular Structure |
|
| Tetthet |
2.013g/cm3 |
| Smeltepunkt |
-55℃ |
| Kokepunkt |
89.7°C at 760 mmHg |
| Brytningsindeks |
1.503 |
| Flammepunktet |
1.3°C |
| Hazard symboler |
 Xn:Harmful;
|
| Risiko Koder |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
| Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
