ChemNet > CAS > 758-16-7 N,N-Dimethylthioformamide
758-16-7 N,N-Dimethylthioformamide
| produktnavn |
N,N-Dimethylthioformamide |
| Synonymer |
NN-Dimethylthioformamide |
| Molekylær Formel |
C3H7NS |
| Molekylvekt |
89.1594 |
| InChI |
InChI=1/C3H7NS/c1-4(2)3-5/h3H,1-2H3 |
| CAS-nummer |
758-16-7 |
| EINECS |
212-060-7 |
| Molecular Structure |
|
| Tetthet |
0.985g/cm3 |
| Kokepunkt |
224.9°C at 760 mmHg |
| Brytningsindeks |
1.511 |
| Flammepunktet |
89.8°C |
| Hazard symboler |
 Xn:Harmful;
|
| Risiko Koder |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Sikkerhet Beskrivelse |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|
